For research use only. Not for therapeutic Use.
1,2-Dihydro-2-oxo-4-quinolinecarboxylic acid is a quinoline derivative featuring a keto group at the 2-position and a carboxylic acid group at the 4-position. This compound is of interest in medicinal chemistry due to the quinoline core, which is commonly found in bioactive molecules with antimicrobial, anticancer, and anti-inflammatory properties. Its structure makes it a valuable intermediate for the synthesis of pharmaceuticals and other complex organic compounds, with potential applications in drug discovery and the development of therapeutic agents.
CAS Number | 15733-89-8 |
Synonyms | 2-hydroxy-cinchoninic Acid; 1,2-Dihydro-2-oxo-4-quinolinecarboxylic Acid; 2-Hydroxy-4-quinolinecarboxylic Acid; 2-Hydroxycinchoninic Acid; 2-Hydroxyquinoline-4-carboxylic Acid; 4-Carboxycarbostyril; NSC 3564 |
Molecular Formula | C10H7NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-oxo-1H-quinoline-4-carboxylic acid |
InChI | InChI=1S/C10H7NO3/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9/h1-5H,(H,11,12)(H,13,14) |
InChIKey | MFSHNFBQNVGXJX-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=CC(=O)N2)C(=O)O |