For research use only. Not for therapeutic Use.
1-(1-Benzothiophen-3-yl)ethan-1-amine(Cat No.:L007287), is a chemical compound used in various research and industrial applications. It is classified as an organic amine due to the presence of the amino group (-NH2) and contains a benzothiophene ring. Compounds with benzothiophene motifs are of interest in medicinal chemistry, as they exhibit diverse biological activities. Researchers explore derivatives of benzothiophenes for their potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer effects. Additionally, these compounds are valuable building blocks in the synthesis of organic molecules, making them essential in pharmaceutical research and development.
CAS Number | 158868-44-1 |
Molecular Formula | C10H11NS |
Purity | ≥95% |
IUPAC Name | 1-(1-benzothiophen-3-yl)ethanamine |
InChI | InChI=1S/C10H11NS/c1-7(11)9-6-12-10-5-3-2-4-8(9)10/h2-7H,11H2,1H3 |
InChIKey | QHQWHUVCNWLPGV-UHFFFAOYSA-N |
SMILES | CC(C1=CSC2=CC=CC=C21)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |