For research use only. Not for therapeutic Use.
1-(1-Methyl-1H-pyrazol-3-yl)ethan-1-ol(Cat No.:L007829), is a significant chemical compound known for its diverse applications in research and industry. This compound possesses a pyrazole ring, a methyl group, and a hydroxyethyl moiety, making it valuable in medicinal chemistry, drug development, and organic synthesis. Researchers use it as a building block to design and synthesize novel molecules for pharmaceutical purposes. Its unique structure and reactivity allow for the creation of specialized chemicals and pharmaceutical intermediates, enabling advancements in the field of medicine.
CAS Number | 60031-47-2 |
Molecular Formula | C6H10N2O |
Purity | ≥95% |
IUPAC Name | 1-(1-methylpyrazol-3-yl)ethanol |
InChI | InChI=1S/C6H10N2O/c1-5(9)6-3-4-8(2)7-6/h3-5,9H,1-2H3 |
InChIKey | IYZHSRBTZXDIHP-UHFFFAOYSA-N |
SMILES | CC(C1=NN(C=C1)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |