For research use only. Not for therapeutic Use.
1-(1-Naphthyl)cyclopropanecarbonitrile (Cat.No:L003333) is a vital chemical compound with diverse applications in pharmaceutical research. Its unique structure and reactivity make it a promising scaffold for the synthesis of novel pharmaceuticals, highlighting its significance in modern drug discovery.
| Catalog Number | L003333 |
| CAS Number | 56477-59-9 |
| Molecular Formula | C14H11N |
| Purity | ≥95% |
| IUPAC Name | 1-naphthalen-1-ylcyclopropane-1-carbonitrile |
| InChI | InChI=1S/C14H11N/c15-10-14(8-9-14)13-7-3-5-11-4-1-2-6-12(11)13/h1-7H,8-9H2 |
| InChIKey | KZFLDUJYFFFLRT-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C2=CC=CC3=CC=CC=C32 |
