For research use only. Not for therapeutic Use.
1-(1-Naphthylmethyl)piperazine(Cat No.:L006904), is a chemical compound used in medicinal chemistry and pharmaceutical research. Its molecular structure consists of a piperazine ring with a naphthylmethyl substituent. This compound acts as a key intermediate in the synthesis of various organic derivatives, including potential drug candidates. Researchers utilize it to design and develop new molecules for therapeutic applications, especially in the fields of neuroscience and mental health.
Catalog Number | L006904 |
CAS Number | 40675-81-8 |
Molecular Formula | C15H18N2 |
Purity | ≥95% |
IUPAC Name | 1-(naphthalen-1-ylmethyl)piperazine |
InChI | InChI=1S/C15H18N2/c1-2-7-15-13(4-1)5-3-6-14(15)12-17-10-8-16-9-11-17/h1-7,16H,8-12H2 |
InChIKey | HGYDREHWXXUUIS-UHFFFAOYSA-N |
SMILES | C1CN(CCN1)CC2=CC=CC3=CC=CC=C32 |