For research use only. Not for therapeutic Use.
(+/-)-1-(1,3-Benzodioxol-5-yl)-2-bromo-1-pentanone (Cat No.:R049959) is a chemical compound. It consists of a 1,3-benzodioxole ring fused to a pentanone moiety with a bromine substituent. This compound is significant in organic synthesis and medicinal chemistry for its potential to introduce specific functional groups and create diverse molecules. The presence of the benzodioxole ring imparts unique reactivity, influencing its utility in constructing complex structures. It can serve as a precursor for various bioactive compounds. The compound’s structural features and reactivity contribute to its role in developing novel molecules for pharmaceutical and chemical research applications.
CAS Number | 146721-06-4 |
Molecular Formula | C12H13BrO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-bromopentan-1-one |
InChI | InChI=1S/C12H13BrO3/c1-2-3-9(13)12(14)8-4-5-10-11(6-8)16-7-15-10/h4-6,9H,2-3,7H2,1H3 |
InChIKey | FQBSUOHBUXPEHI-UHFFFAOYSA-N |
SMILES | CCCC(C(=O)C1=CC2=C(C=C1)OCO2)Br |