For research use only. Not for therapeutic Use.
1-(2-(4-Nitrophenoxy)ethyl)pyrrolidine(Cat No.:L043257)is a chemical compound that features a pyrrolidine ring linked to a 4-nitrophenoxyethyl group. This compound is valuable in pharmaceutical research and organic synthesis as a versatile intermediate in the development of bioactive molecules, including drug candidates. The nitrophenoxy group provides opportunities for further functionalization, while the pyrrolidine moiety is often found in biologically active compounds. Its structure makes it useful in creating complex molecular architectures for applications in medicinal chemistry and drug discovery. High purity ensures consistent results in advanced research settings.
CAS Number | 265654-77-1 |
Molecular Formula | C12H16N2O3 |
Purity | ≥95% |
IUPAC Name | 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine |
InChI | InChI=1S/C12H16N2O3/c15-14(16)11-3-5-12(6-4-11)17-10-9-13-7-1-2-8-13/h3-6H,1-2,7-10H2 |
InChIKey | RZIYRKYHMDDHCK-UHFFFAOYSA-N |
SMILES | C1CCN(C1)CCOC2=CC=C(C=C2)[N+](=O)[O-] |