For research use only. Not for therapeutic Use.
1-(2-Amino-4-(trifluoromethyl)phenyl)ethanone(Cat No.:L037983)is a valuable compound in pharmaceutical and chemical research, recognized for its unique structure featuring an amino group and a trifluoromethyl group attached to a phenyl ring. This compound serves as a crucial intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals. Its distinctive chemical properties enable the creation of various derivatives, making it essential for medicinal chemistry and drug discovery. 1-(2-Amino-4-(trifluoromethyl)phenyl)ethanone supports high-precision research, contributing to the advancement of innovative therapeutic solutions.
CAS Number | 37885-07-7 |
Molecular Formula | C9H8F3NO |
Purity | ≥95% |
IUPAC Name | 1-[2-amino-4-(trifluoromethyl)phenyl]ethanone |
InChI | InChI=1S/C9H8F3NO/c1-5(14)7-3-2-6(4-8(7)13)9(10,11)12/h2-4H,13H2,1H3 |
InChIKey | ALHLVWOGPMHZHJ-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=C(C=C1)C(F)(F)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |