For research use only. Not for therapeutic Use.
1-(2-Amino-5-fluoro-4-methoxyphenyl)ethan-1-one(Cat No.:L007371), is a chemical compound with a molecular structure consisting of a phenyl ring bearing an amino group at the 2nd carbon, a fluoro group at the 5th carbon, and a methoxy group at the 4th carbon. This unique arrangement of atoms imparts specific chemical properties, making it valuable in medicinal chemistry and organic synthesis. Scientists utilize this compound as a building block to create more complex molecules for pharmaceutical research, studying its reactivity and interactions with other compounds.
CAS Number | 1444356-81-3 |
Molecular Formula | C9H10FNO2 |
Purity | ≥95% |
IUPAC Name | 1-(2-amino-5-fluoro-4-methoxyphenyl)ethanone |
InChI | InChI=1S/C9H10FNO2/c1-5(12)6-3-7(10)9(13-2)4-8(6)11/h3-4H,11H2,1-2H3 |
InChIKey | QVOLWVXAPXPUQM-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=C(C=C1N)OC)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |