For research use only. Not for therapeutic Use.
1-(2-Aminoethyl)-1H-pyrrole-2,5-dione (Cat No.:M136261) is a chemical compound with a molecular formula C6H8N2O2. It features a pyrrole ring with a carboxylic acid and an aminoethyl group. Due to its structural diversity, this compound finds utility in medicinal and chemical research. It can serve as a building block in organic synthesis and drug discovery. The presence of an amino group enhances its potential for forming various chemical interactions. Its unique structure and reactivity make it valuable for creating novel molecules with biological or industrial relevance.
CAS Number | 125923-10-6 |
Synonyms | 1-(2-aMinoethyl)-1H-pyrrole-2,5-dione |
Molecular Formula | C6H8N2O2 |
Purity | ≥95% |
Storage | Store at -20 °C |
IUPAC Name | 1-(2-aminoethyl)pyrrole-2,5-dione |
InChI | InChI=1S/C6H8N2O2/c7-3-4-8-5(9)1-2-6(8)10/h1-2H,3-4,7H2 |
InChIKey | ODVRLSOMTXGTMX-UHFFFAOYSA-N |
SMILES | C1=CC(=O)N(C1=O)CCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |