For research use only. Not for therapeutic Use.
1-(2-Bromo-3-fluorophenyl)ethanone(CAT: L032468) is an aromatic ketone compound commonly used as a building block in pharmaceutical and chemical research. Featuring both bromine and fluorine substituents on a phenyl ring, it provides unique reactivity for diverse organic synthesis applications, including halogen exchange and cross-coupling reactions. This compound is particularly valuable in the development of bioactive molecules, agrochemicals, and functional materials. With high purity and stability, 1-(2-Bromo-3-fluorophenyl)ethanone supports innovative research in medicinal chemistry and advanced material science, facilitating the synthesis of complex molecular frameworks.
CAS Number | 161957-58-0 |
Molecular Formula | C8H6BrFO |
Purity | ≥95% |
IUPAC Name | 1-(2-bromo-3-fluorophenyl)ethanone |
InChI | InChI=1S/C8H6BrFO/c1-5(11)6-3-2-4-7(10)8(6)9/h2-4H,1H3 |
InChIKey | WBMUEFOEEVGDNQ-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C(=CC=C1)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |