For research use only. Not for therapeutic Use.
1-(2-Bromo-3-methylphenyl)ethanone(CAT: L031468) is a high-purity aromatic ketone compound widely used in pharmaceutical, chemical, and organic synthesis research. Featuring a bromo-substituted and methyl-substituted phenyl group attached to an ethanone backbone, this compound serves as a versatile intermediate for synthesizing bioactive molecules, fine chemicals, and advanced materials. Its unique structure makes it particularly valuable in medicinal chemistry for the development of therapeutic agents and the study of structure-activity relationships. With excellent stability and reactivity, 1-(2-Bromo-3-methylphenyl)ethanone ensures precision and reliability, making it an essential tool for advanced synthetic and research applications.
CAS Number | 944268-58-0 |
Molecular Formula | C9H9BrO |
Purity | ≥95% |
IUPAC Name | 1-(2-bromo-3-methylphenyl)ethanone |
InChI | InChI=1S/C9H9BrO/c1-6-4-3-5-8(7(2)11)9(6)10/h3-5H,1-2H3 |
InChIKey | KFBAJJMHDBXFIB-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)C(=O)C)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |