For research use only. Not for therapeutic Use.
1-(2-Bromo-4-fluorophenyl)ethanamine (Cat.No:L003803) is a significant chemical compound with applications in medicinal chemistry. Its distinct structure, featuring a bromo-fluorophenyl group, imparts unique reactivity and pharmacological properties. This compound serves as a crucial intermediate in the synthesis of specialized pharmaceutical agents. Its versatile nature makes it a key component in the development of novel drugs.
CAS Number | 1086599-35-0 |
Molecular Formula | C8H9BrFN |
Purity | ≥95% |
IUPAC Name | 1-(2-bromo-4-fluorophenyl)ethanamine |
InChI | InChI=1S/C8H9BrFN/c1-5(11)7-3-2-6(10)4-8(7)9/h2-5H,11H2,1H3 |
InChIKey | CASYPDKXSSJANQ-UHFFFAOYSA-N |
SMILES | CC(C1=C(C=C(C=C1)F)Br)N |