For research use only. Not for therapeutic Use.
1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one (Cat.No:M019863) is a chemical compound with potential applications in organic synthesis and medicinal chemistry. Its structure features a ketone group attached to a chlorophenoxyphenyl ring. This compound serves as a valuable intermediate in the preparation of diverse molecules for pharmaceutical and research purposes.
Catalog Number | M019863 |
CAS Number | 119851-28-4 |
Molecular Formula | C14H10Cl2O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1-[2-chloro-4-(4-chlorophenoxy)phenyl]ethanone |
InChI | InChI=1S/C14H10Cl2O2/c1-9(17)13-7-6-12(8-14(13)16)18-11-4-2-10(15)3-5-11/h2-8H,1H3 |
InChIKey | BDTJIVUVQRVLLJ-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=C(C=C1)OC2=CC=C(C=C2)Cl)Cl |