For research use only. Not for therapeutic Use.
1-(2-chlorophenyl)-1H-pyrazol-3-amine(Cat No.:L007263), is a chemical compound important in pharmaceutical and research applications. Its molecular formula is C9H8ClN3. This compound is of interest due to its potential biological activities and is widely studied in medicinal chemistry. Researchers investigate its interactions with biological targets, aiming to develop new drugs for various diseases. The compound’s structure makes it valuable in the design and synthesis of novel molecules, contributing to the ongoing efforts in drug discovery and development. Its diverse applications showcase its significance in advancing the field of medicinal chemistry and pharmacology.
CAS Number | 76091-02-6 |
Molecular Formula | C9H8ClN3 |
Purity | ≥95% |
IUPAC Name | 1-(2-chlorophenyl)pyrazol-3-amine |
InChI | InChI=1S/C9H8ClN3/c10-7-3-1-2-4-8(7)13-6-5-9(11)12-13/h1-6H,(H2,11,12) |
InChIKey | SDVLYOOTZZBLCN-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)N2C=CC(=N2)N)Cl |