For research use only. Not for therapeutic Use.
1-(2-Chlorophenyl)-2,2,2-trifluoroethanamine(Cat No.:L035019)is an organic compound used in pharmaceutical research and organic synthesis. The molecule features a 2-chlorophenyl group attached to a trifluoroethylamine backbone, providing unique electronic and steric properties. This compound is particularly valuable as an intermediate in the synthesis of biologically active molecules, such as potential drug candidates. The presence of the trifluoromethyl group enhances metabolic stability and bioavailability, while the amine functionality allows for further chemical modifications. It is essential for researchers focused on drug discovery, medicinal chemistry, and advanced synthetic applications.
CAS Number | 886370-54-3 |
Molecular Formula | C8H7ClF3N |
Purity | ≥95% |
IUPAC Name | 1-(2-chlorophenyl)-2,2,2-trifluoroethanamine |
InChI | InChI=1S/C8H7ClF3N/c9-6-4-2-1-3-5(6)7(13)8(10,11)12/h1-4,7H,13H2 |
InChIKey | DLIXGNJUPCBBER-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)N)Cl |