For research use only. Not for therapeutic Use.
1-[(2-Chlorophenyl)(methylimino)methyl]cyclopentanol is an organic compound featuring a cyclopentanol core with a 2-chlorophenyl and a methylimino group. This structure makes it useful in medicinal chemistry and pharmaceutical research. The compound’s unique functional groups allow it to interact with various biological targets, making it a potential candidate for developing new therapeutic agents. Its synthesis and study contribute to understanding structure-activity relationships in drug development.
Catalog Number | R044829 |
CAS Number | 6740-87-0 |
Synonyms | USP Ketamine Related Compound A; |
Molecular Formula | C13H16ClNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-[C-(2-chlorophenyl)-N-methylcarbonimidoyl]cyclopentan-1-ol |
InChI | InChI=1S/C13H16ClNO/c1-15-12(13(16)8-4-5-9-13)10-6-2-3-7-11(10)14/h2-3,6-7,16H,4-5,8-9H2,1H3 |
InChIKey | FJGPXUPMNZOTLX-UHFFFAOYSA-N |
SMILES | CN=C(C1=CC=CC=C1Cl)C2(CCCC2)O |