Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(2-Fluorobenzoyl)piperidine-4-carboxylic acid
For research use only. Not for therapeutic Use.
1-(2-Fluorobenzoyl)piperidine-4-carboxylic acid(CAT: L042381) is a specialized chemical compound featuring a piperidine backbone functionalized with a 2-fluorobenzoyl group and a carboxylic acid moiety. This versatile compound serves as a key intermediate in pharmaceutical research, particularly in the synthesis of bioactive molecules and drug candidates. Its unique structure allows for diverse applications in medicinal chemistry, including the development of receptor modulators and enzyme inhibitors. With high purity and excellent stability, 1-(2-Fluorobenzoyl)piperidine-4-carboxylic acid is an essential building block for innovative drug discovery and chemical synthesis projects.
CAS Number | 445226-98-2 |
Molecular Formula | C13H14FNO3 |
Purity | ≥95% |
IUPAC Name | 1-(2-fluorobenzoyl)piperidine-4-carboxylic acid |
InChI | InChI=1S/C13H14FNO3/c14-11-4-2-1-3-10(11)12(16)15-7-5-9(6-8-15)13(17)18/h1-4,9H,5-8H2,(H,17,18) |
InChIKey | IXXILHJJXBPAHT-UHFFFAOYSA-N |
SMILES | C1CN(CCC1C(=O)O)C(=O)C2=CC=CC=C2F |