For research use only. Not for therapeutic Use.
1-(2-Methoxyphenyl)propan-1-one(CAT: L000046) is a chemical compound with applications primarily in organic chemistry. This compound serves as an important intermediate for the synthesis of various organic compounds, contributing to the diversification of chemical synthesis. Its unique structure, featuring a propan-1-one group and a methoxyphenyl moiety, offers opportunities for creating specialized molecules with potential uses in various areas within the field of organic chemistry.
CAS Number | 5561-92-2 |
Molecular Formula | C10H12O2 |
Purity | ≥95% |
IUPAC Name | 1-(2-methoxyphenyl)propan-1-one |
InChI | InChI=1S/C10H12O2/c1-3-9(11)8-6-4-5-7-10(8)12-2/h4-7H,3H2,1-2H3 |
InChIKey | LEAJWPFHMHVEKV-UHFFFAOYSA-N |