For research use only. Not for therapeutic Use.
1-(2-Methylpropyl)-1H-pyrazol-4-amine(CAT: L020294) is a pyrazole derivative featuring a 2-methylpropyl group attached to the nitrogen atom at position 1 and an amine group at position 4. This compound is of interest in organic synthesis and pharmaceutical research due to the pyrazole ring, which is a core structure in many bioactive compounds, including anti-inflammatory, antimicrobial, and anticancer agents. The presence of the 2-methylpropyl group can influence the molecule’s lipophilicity and potential biological interactions, while the amine group provides a site for further functionalization. 1-(2-Methylpropyl)-1H-pyrazol-4-amine serves as a valuable building block in drug discovery and medicinal chemistry.
CAS Number | 405548-42-7 |
Molecular Formula | C7H13N3 |
Purity | ≥95% |
IUPAC Name | 1-(2-methylpropyl)pyrazol-4-amine |
InChI | InChI=1S/C7H13N3/c1-6(2)4-10-5-7(8)3-9-10/h3,5-6H,4,8H2,1-2H3 |
InChIKey | SGUQYNMBZJPCLA-UHFFFAOYSA-N |