For research use only. Not for therapeutic Use.
1-(2-Methylpyrimidin-4-yl)piperidin-4-amine(Cat No.:L007377), is a chemical compound with a significant role in medicinal chemistry. Its structure incorporates a piperidine ring with an appended pyrimidine moiety, making it valuable for drug discovery efforts. Compounds with similar structures are often studied as potential pharmaceutical agents, as they can interact with biological targets in the body, such as proteins or enzymes, to elicit specific therapeutic effects. Researchers utilize these molecules as starting points for the development of new medications, aiming to address various diseases and conditions.
CAS Number | 1329748-51-7 |
Molecular Formula | C10H16N4 |
Purity | ≥95% |
IUPAC Name | 1-(2-methylpyrimidin-4-yl)piperidin-4-amine |
InChI | InChI=1S/C10H16N4/c1-8-12-5-2-10(13-8)14-6-3-9(11)4-7-14/h2,5,9H,3-4,6-7,11H2,1H3 |
InChIKey | UXJXGDDZKLKKEW-UHFFFAOYSA-N |
SMILES | CC1=NC=CC(=N1)N2CCC(CC2)N |