For research use only. Not for therapeutic Use.
1-(2-(Methylthio)pyrimidin-4-yl)ethanone is a heterocyclic compound featuring a pyrimidine ring substituted with a methylthio (-SCH₃) group at the 2-position and an ethanone (-COCH₃) group at the 1-position. The combination of sulfur and carbonyl functionalities on the pyrimidine ring contributes to its unique chemical reactivity and potential biological activity. Often used as a synthetic intermediate, this compound is valuable in medicinal chemistry for developing pharmaceuticals, particularly in antiviral, anticancer, and antimicrobial research due to its versatile scaffold.
CAS Number | 496863-48-0 |
Molecular Formula | C7H8N2OS |
Purity | ≥95% |
IUPAC Name | 1-(2-methylsulfanylpyrimidin-4-yl)ethanone |
InChI | InChI=1S/C7H8N2OS/c1-5(10)6-3-4-8-7(9-6)11-2/h3-4H,1-2H3 |
InChIKey | WXQMROLQWGTVBM-UHFFFAOYSA-N |
SMILES | CC(=O)C1=NC(=NC=C1)SC |