For research use only. Not for therapeutic Use.
1-(2-Naphthyl)propan-1-one(CAT: L030189) is an aromatic ketone that contains a naphthalene ring attached to a propanone chain. This compound is commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals, fragrances, and specialty chemicals. The naphthyl group contributes to its aromatic stability and hydrophobic properties, while the ketone functional group at the propanone side chain allows for further reactivity, such as in aldol condensations or reductions. In medicinal chemistry, it can serve as a scaffold for designing bioactive molecules due to its aromaticity and structural rigidity, which can be beneficial for receptor binding and enhancing biological activity.
CAS Number | 6315-96-4 |
Molecular Formula | C13H12O |
Purity | ≥95% |
IUPAC Name | 1-naphthalen-2-ylpropan-1-one |
InChI | InChI=1S/C13H12O/c1-2-13(14)12-8-7-10-5-3-4-6-11(10)9-12/h3-9H,2H2,1H3 |
InChIKey | QLYPHTMKMPIJNG-UHFFFAOYSA-N |