For research use only. Not for therapeutic Use.
1-(2-Nitroethyl)-2-naphthol is an organic compound characterized by a nitroethyl group attached to a naphthol structure. This compound is used in chemical research and synthesis, particularly in the development of dyes, pigments, and pharmaceuticals. Its unique chemical properties make it valuable for studying reaction mechanisms and for creating intermediates in various organic synthesis processes.
CAS Number | 96853-41-7 |
Molecular Formula | C12H11NO3 |
Purity | ≥95% |
Storage | +4 ℃ |
IUPAC Name | 1-(2-nitroethyl)naphthalen-2-ol |
InChI | InChI=1S/C12H11NO3/c14-12-6-5-9-3-1-2-4-10(9)11(12)7-8-13(15)16/h1-6,14H,7-8H2 |
InChIKey | KPBFKBMFARSVIH-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC(=C2CC[N+](=O)[O-])O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |