For research use only. Not for therapeutic Use.
1-(2-Nitrovinyl)-4-(trifluoromethyl)benzene(Cat No.:L006725), is a chemical compound featuring a benzene ring substituted with a nitrovinyl group at the 1st position and a trifluoromethyl group at the 4th position. This compound is significant in organic synthesis, utilized as a valuable intermediate for the preparation of various functionalized benzene derivatives. Its specific structure enhances its reactivity, making it useful for creating complex organic molecules. Researchers leverage 1-(2-Nitrovinyl)-4-(trifluoromethyl)benzene as a versatile building block, contributing significantly to the development of pharmaceuticals, agrochemicals, and specialty chemicals, thus aiding advancements in drug discovery and materials science applications.
CAS Number | 93628-97-8 |
Molecular Formula | C9H6F3NO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-[(E)-2-nitroethenyl]-4-(trifluoromethyl)benzene |
InChI | InChI=1S/C9H6F3NO2/c10-9(11,12)8-3-1-7(2-4-8)5-6-13(14)15/h1-6H/b6-5+ |
InChIKey | CATQYSSYYQMLHV-AATRIKPKSA-N |
SMILES | C1=CC(=CC=C1C=C[N+](=O)[O-])C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |