For research use only. Not for therapeutic Use.
1-(2-Pyridinyl)benzotriazole-15N3 is a labeled chemical compound where three nitrogen atoms are replaced with the nitrogen-15 isotope. This compound is used in research applications involving the study of reaction mechanisms, especially in the context of nitrogen-containing heterocycles. The nitrogen-15 labeling allows for precise tracking and analysis using techniques like NMR spectroscopy and mass spectrometry. This compound is particularly valuable for investigating the behavior of nitrogen atoms in chemical reactions, helping to elucidate mechanisms and pathways in organic synthesis and pharmaceutical development.
CAS Number | 1189465-04-0 |
Synonyms | 1-(2-Pyridyl)-1H-benzotriazole-15N3 |
Molecular Formula | C11H8N4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-pyridin-2-ylbenzotriazole |
InChI | InChI=1S/C11H8N4/c1-2-6-10-9(5-1)13-14-15(10)11-7-3-4-8-12-11/h1-8H/i12+1,13+1,15+1 |
InChIKey | CPWBWUGSSFRASR-OYMGSPLNSA-N |
SMILES | C1=CC=C2C(=C1)N=NN2C3=CC=CC=N3 |