For research use only. Not for therapeutic Use.
1-(2,3,4-Trifluorophenyl)ethan-1-amine(CAT: L018010) is an organic compound that features a trifluorophenyl group attached to an ethanamine backbone. The trifluorophenyl moiety, with fluorine atoms at the 2, 3, and 4 positions, significantly influences the compound’s physicochemical properties, such as lipophilicity and metabolic stability. This structure is commonly investigated in medicinal chemistry for its potential role as a pharmacophore in drug design, often contributing to the development of molecules with enhanced potency, receptor selectivity, and improved pharmacokinetics. It is particularly useful in the synthesis of small-molecule inhibitors, neurotransmitter analogs, or other therapeutic agents.
CAS Number | 780027-85-2 |
Molecular Formula | C8H8F3N |
Purity | ≥95% |
IUPAC Name | 1-(2,3,4-trifluorophenyl)ethanamine |
InChI | InChI=1S/C8H8F3N/c1-4(12)5-2-3-6(9)8(11)7(5)10/h2-4H,12H2,1H3 |
InChIKey | OFWOWFVJVVUHSM-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |