For research use only. Not for therapeutic Use.
1-(2,6-Difluorophenyl)cyclopropan-1-ol(CAT: L000421) is a significant compound with applications primarily in organic chemistry. This molecule serves as a valuable intermediate in various organic reactions and the synthesis of specialized organic compounds. Its structure, containing a cyclopropane ring and a difluorophenyl group, is instrumental in introducing specific chemical features into organic molecules, making it essential for designing and producing novel compounds with tailored properties.
CAS Number | 1250163-79-1 |
Molecular Formula | C9H8F2O |
Purity | ≥95% |
IUPAC Name | 1-(2,6-difluorophenyl)cyclopropan-1-ol |
InChI | InChI=1S/C9H8F2O/c10-6-2-1-3-7(11)8(6)9(12)4-5-9/h1-3,12H,4-5H2 |
InChIKey | SRUNPIFYQNAODL-UHFFFAOYSA-N |