For research use only. Not for therapeutic Use.
1-(2,6-Dimethylphenoxy)-2-propanone oxime (Cat No.:C000782) is a chemical compound featuring a propanone backbone with an oxime functional group and a 2,6-dimethylphenoxy substituent. This compound holds significance in organic synthesis and potential applications in pharmaceutical research. Its unique structure suggests reactivity and potential interactions in chemical reactions. Researchers may explore its properties, potential biological activities, and uses as a reagent or intermediate.
CAS Number | 55304-19-3 |
Synonyms | Mexiletine Impurity; |
Molecular Formula | C₁₁H₁₅NO₂ |
Purity | ≥95% |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | 4°C, Hygroscopic |
IUPAC Name | (NE)-N-[1-(2,6-dimethylphenoxy)propan-2-ylidene]hydroxylamine |
InChI | InChI=1S/C11H15NO2/c1-8-5-4-6-9(2)11(8)14-7-10(3)12-13/h4-6,13H,7H2,1-3H3/b12-10+ |
InChIKey | DJQNMCARGAAZBX-ZRDIBKRKSA-N |
SMILES | CC1=C(C(=CC=C1)C)OCC(=NO)C |