For research use only. Not for therapeutic Use.
1-[(2S)-2-Amino-1-oxo-3-phenylpropyl]pyrrolidine is a pyrrolidine derivative with potential applications in medicinal chemistry. This compound features an amino acid structure combined with a pyrrolidine ring, suggesting possible bioactivity in modulating neurotransmitter pathways. Its unique configuration may contribute to its efficacy as a pharmacological agent. Research is ongoing to explore its therapeutic properties, particularly in neuropharmacology and drug design, as it may serve as a scaffold for developing new compounds with enhanced activity against various neurological disorders.
Catalog Number | R009832 |
CAS Number | 56414-89-2 |
Synonyms | (2S)-2-Amino-3-phenyl-1-(1-pyrrolidinyl)-1-propanone; ?(S)-1-(2-Amino-1-oxo-3-phenylpropyl)pyrrolidine? |
Molecular Formula | C13H18N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-3-phenyl-1-pyrrolidin-1-ylpropan-1-one |
InChI | InChI=1S/C13H18N2O/c14-12(10-11-6-2-1-3-7-11)13(16)15-8-4-5-9-15/h1-3,6-7,12H,4-5,8-10,14H2/t12-/m0/s1 |
InChIKey | XJPALNDNNCWDJU-LBPRGKRZSA-N |
SMILES | C1CCN(C1)C(=O)C(CC2=CC=CC=C2)N |