For research use only. Not for therapeutic Use.
L-Uridine(Cat No.:L047131)is a naturally occurring nucleoside involved in various biological processes, including RNA synthesis and cellular metabolism. It plays a critical role in the biosynthesis of pyrimidine nucleotides, which are essential for DNA and RNA production. L-Uridine has been studied for its neuroprotective properties and its potential to enhance cognitive function and memory. It is also explored in the treatment of mitochondrial disorders and liver diseases. L-Uridine is widely used in biochemical research and pharmaceutical development for its role in nucleic acid metabolism and therapeutic applications.
CAS Number | 26287-69-4 |
Molecular Formula | C9H12N2O6 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m0/s1 |
InChIKey | DRTQHJPVMGBUCF-PSQAKQOGSA-N |
SMILES | C1=CN(C(=O)NC1=O)[C@@H]2[C@H]([C@H]([C@@H](O2)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |