For research use only. Not for therapeutic Use.
1-(3-(4-Aminophenyl)propanoyl)azetidin-2-one (CAT: L000183) is a chemical compound with applications in organic chemistry and potentially in pharmaceutical research. Its action mechanism involves its role as an intermediate in various chemical reactions, making it a valuable building block for the synthesis of complex organic molecules. In the field of organic chemistry, this compound is significant for creating pharmaceutical intermediates and specialty chemicals.
CAS Number | 1024869-25-7 |
Molecular Formula | C12H14N2O2 |
Purity | ≥95% |
IUPAC Name | 1-[3-(4-aminophenyl)propanoyl]azetidin-2-one |
InChI | InChI=1S/C12H14N2O2/c13-10-4-1-9(2-5-10)3-6-11(15)14-8-7-12(14)16/h1-2,4-5H,3,6-8,13H2 |
InChIKey | CCVFEHRZMGTCMR-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |