For research use only. Not for therapeutic Use.
1-(3-Bromophenyl)ethanamine(CAT: L043134) is an organic compound featuring a bromine atom attached to the phenyl ring at the 3-position and an ethanamine (ethylamine) group attached at the 1-position of the phenyl ring. This structure makes it a versatile intermediate in organic synthesis, particularly for the preparation of pharmaceuticals and agrochemicals. The presence of both the bromine and amine functional groups allows for further chemical modifications, such as cross-coupling reactions or amide formation. It is useful in medicinal chemistry for the development of bioactive molecules, including potential drug candidates, due to the reactivity and functional versatility of the ethanamine group.
CAS Number | 74877-08-0 |
Molecular Formula | C8H10BrN |
Purity | ≥95% |
IUPAC Name | 1-(3-bromophenyl)ethanamine |
InChI | InChI=1S/C8H10BrN/c1-6(10)7-3-2-4-8(9)5-7/h2-6H,10H2,1H3 |
InChIKey | LIBZHYLTOAGURM-UHFFFAOYSA-N |