For research use only. Not for therapeutic Use.
1-(3-Bromopropyl)-4-methoxybenzene(Cat No.:L006874), is an organic compound utilized in various chemical applications, particularly in synthesis and research. Its molecular structure consists of a methoxybenzene ring with a 3-bromopropyl substituent. This compound is employed as a key intermediate in the preparation of complex organic molecules, including pharmaceuticals, agrochemicals, and specialty chemicals. Researchers use it as a versatile building block to introduce specific functionalities in organic compounds.
CAS Number | 57293-19-3 |
Molecular Formula | C10H13BrO |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 1-(3-bromopropyl)-4-methoxybenzene |
InChI | InChI=1S/C10H13BrO/c1-12-10-6-4-9(5-7-10)3-2-8-11/h4-7H,2-3,8H2,1H3 |
InChIKey | CPHLODVMQBMDNC-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)CCCBr |