For research use only. Not for therapeutic Use.
1-(3-Bromopyridin-2-yl)cyclopropanecarbonitrile(CAT: L026010) is a heterocyclic compound featuring a 3-bromopyridine ring attached to a cyclopropane carbonitrile group. The bromine atom at the 3-position of the pyridine ring introduces reactivity that facilitates further functionalization, while the cyclopropane ring adds rigidity and unique spatial characteristics to the molecule. This compound is commonly used in pharmaceutical research, especially as a building block in the synthesis of bioactive molecules, including kinase inhibitors and receptor modulators. 1-(3-Bromopyridin-2-yl)cyclopropanecarbonitrile serves as an intermediate in drug discovery and materials science for developing compounds with therapeutic potential, due to its structural versatility and reactivity.
CAS Number | 1876944-81-8 |
Molecular Formula | C9H7BrN2 |
Purity | ≥95% |
IUPAC Name | 1-(3-bromopyridin-2-yl)cyclopropane-1-carbonitrile |
InChI | InChI=1S/C9H7BrN2/c10-7-2-1-5-12-8(7)9(6-11)3-4-9/h1-2,5H,3-4H2 |
InChIKey | QADYZSDMZMKJHT-UHFFFAOYSA-N |