Home
>
Chemical Reagents>Organic Building Blocks> 1-(3-Chloro-5-fluorophenyl)ethanamine hydrochloride
For research use only. Not for therapeutic Use.
1-(3-Chloro-5-fluorophenyl)ethanamine hydrochloride (Cat.No:L003373) is a crucial chemical compound with diverse applications in pharmaceutical research. Its distinctive structure makes it a promising building block in the synthesis of novel pharmaceuticals, emphasizing its significance in modern drug discovery endeavors.
Catalog Number | L003373 |
CAS Number | 2203194-97-0 |
Molecular Formula | C8H10Cl2FN |
Purity | ≥95% |
IUPAC Name | 1-(3-chloro-5-fluorophenyl)ethanamine;hydrochloride |
InChI | InChI=1S/C8H9ClFN.ClH/c1-5(11)6-2-7(9)4-8(10)3-6;/h2-5H,11H2,1H3;1H |
InChIKey | YTFYFLQQTPBAHS-UHFFFAOYSA-N |
SMILES | CC(C1=CC(=CC(=C1)Cl)F)N.Cl |