For research use only. Not for therapeutic Use.
1-(3-Chlorophenyl)-butane-1,3-dione(Cat No.:M115364)is a versatile organic compound widely used in pharmaceutical and chemical research. Featuring a chlorophenyl group attached to a butane-1,3-dione backbone, this compound is a crucial intermediate in the synthesis of various complex molecules, including pharmaceuticals and agrochemicals. Its unique structure allows for diverse chemical modifications, making it valuable in the development of new therapeutic agents. 1-(3-Chlorophenyl)-butane-1,3-dione is essential for high-precision synthesis and innovative research, contributing to the advancement of medicinal chemistry and chemical engineering.
Catalog Number | M115364 |
CAS Number | 128486-09-9 |
Molecular Formula | C10H9ClO2 |
Purity | ≥95% |
IUPAC Name | 1-(3-chlorophenyl)butane-1,3-dione |
InChI | InChI=1S/C10H9ClO2/c1-7(12)5-10(13)8-3-2-4-9(11)6-8/h2-4,6H,5H2,1H3 |
InChIKey | NAVKHJDRCGTULV-UHFFFAOYSA-N |
SMILES | CC(=O)CC(=O)C1=CC(=CC=C1)Cl |