For research use only. Not for therapeutic Use.
1-(3-Chlorophenyl)-1-hydroxy-2-propanone(CAT: R010846) is a chemical compound that may find applications in organic chemistry and synthesis. Its action method involves its potential use as an intermediate or reagent in the synthesis of various organic molecules. Compounds like 1-(3-Chlorophenyl)-1-hydroxy-2-propanone are often employed in organic synthesis to introduce specific structural features or functional groups into molecules, potentially influencing their properties and functions.
CAS Number | 857233-13-7 |
Synonyms | 1-(m-Chlorophenyl)-1-hydroxy-2-propanone; USP Bupropion Related Compound F; |
Molecular Formula | C9H9ClO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(3-chlorophenyl)-1-hydroxypropan-2-one |
InChI | InChI=1S/C9H9ClO2/c1-6(11)9(12)7-3-2-4-8(10)5-7/h2-5,9,12H,1H3 |
InChIKey | HTTAEBUFKZSUKE-UHFFFAOYSA-N |
SMILES | CC(=O)C(C1=CC(=CC=C1)Cl)O |