For research use only. Not for therapeutic Use.
1-(3-Chlorophenyl)pyrazole-4-boronic acid(CAT: L026395) is a heterocyclic compound that contains a pyrazole ring substituted with a 3-chlorophenyl group at the 1st position and a boronic acid group at the 4th position. This structure makes it highly useful in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling, where the boronic acid moiety plays a key role in forming carbon-carbon bonds. The 3-chlorophenyl group adds aromaticity and enhances the compound’s potential biological activity, making it valuable in the development of pharmaceuticals, agrochemicals, and functional materials. It is commonly employed as a building block for creating complex molecular architectures in medicinal chemistry and chemical research.
CAS Number | 1072945-88-0 |
Molecular Formula | C9H8BClN2O2 |
Purity | ≥95% |
IUPAC Name | [1-(3-chlorophenyl)pyrazol-4-yl]boronic acid |
InChI | InChI=1S/C9H8BClN2O2/c11-8-2-1-3-9(4-8)13-6-7(5-12-13)10(14)15/h1-6,14-15H |
InChIKey | QQIIJLJSZUIAKB-UHFFFAOYSA-N |