For research use only. Not for therapeutic Use.
1-(3-Chloropropyl)-1,3-dihydrobenzimidazol-2-one (Cat.No:R059010) is a chemical compound with potential applications in pharmaceutical and chemical synthesis. It is primarily composed of the specified benzimidazolone isomer. This compound may serve as a valuable intermediate in the production of various organic molecules for research and industrial purposes.
CAS Number | 62780-89-6 |
Synonyms | 1-(3-Chloropropyl)-1,3-dihydro-2H-benzimidazol-2-one; |
Molecular Formula | C10H11ClN2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(3-chloropropyl)-1H-benzimidazol-2-one |
InChI | InChI=1S/C10H11ClN2O/c11-6-3-7-13-9-5-2-1-4-8(9)12-10(13)14/h1-2,4-5H,3,6-7H2,(H,12,14) |
InChIKey | GUMPYDGUYXOYML-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC(=O)N2CCCCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |