Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(3-Chloropyridin-2-YL)-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid
For research use only. Not for therapeutic Use.
1-(3-Chloropyridin-2-yl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid(Cat No.:L024787)is a high-purity heterocyclic compound essential for advanced pharmaceutical and chemical research. This molecule features a chloropyridine ring, a trifluoromethyl group, and a pyrazole core with a carboxylic acid functional group, making it a versatile intermediate in the synthesis of bioactive compounds, including potential drug candidates. Its unique structure facilitates specific reactivity, enabling diverse chemical transformations. Ideal for precise synthetic applications, this compound is valuable in the development of new therapeutic agents and innovative research.
CAS Number | 438450-39-6 |
Molecular Formula | C10H5ClF3N3O2 |
Purity | ≥95% |
IUPAC Name | 2-(3-chloropyridin-2-yl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
InChI | InChI=1S/C10H5ClF3N3O2/c11-5-2-1-3-15-8(5)17-6(9(18)19)4-7(16-17)10(12,13)14/h1-4H,(H,18,19) |
InChIKey | CCXJCKFHRYPKEP-UHFFFAOYSA-N |
SMILES | C1=CC(=C(N=C1)N2C(=CC(=N2)C(F)(F)F)C(=O)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |