For research use only. Not for therapeutic Use.
1-(3-Cyclopropylphenyl)ethanone(CAT: L043456) is an important chemical compound in pharmaceutical and organic synthesis. This ketone features a cyclopropyl group attached to the phenyl ring at the 3-position, enhancing its structural diversity and reactivity. The ethanone moiety introduces a carbonyl group, making the compound useful as a building block for synthesizing more complex molecules. In medicinal chemistry, 1-(3-Cyclopropylphenyl)ethanone is often used to develop novel drug candidates targeting various biological pathways, including enzyme inhibition and receptor binding. Its unique structure lends itself to applications in designing molecules with improved pharmacokinetic properties, making it valuable for researchers in drug discovery and development.
CAS Number | 408359-52-4 |
Molecular Formula | C11H12O |
Purity | ≥95% |
IUPAC Name | 1-(3-cyclopropylphenyl)ethanone |
InChI | InChI=1S/C11H12O/c1-8(12)10-3-2-4-11(7-10)9-5-6-9/h2-4,7,9H,5-6H2,1H3 |
InChIKey | ORLYTWCECJKJCQ-UHFFFAOYSA-N |