Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(3-(Difluoromethyl)-1-methyl-1H-pyrazol-4-yl)ethanone
For research use only. Not for therapeutic Use.
1-(3-(Difluoromethyl)-1-methyl-1H-pyrazol-4-yl)ethanone (Cat.No:L003739) is a significant chemical compound in medicinal chemistry. Its unique pyrazole structure, incorporating a difluoromethyl group, imparts valuable pharmacological properties. This compound serves as a key intermediate in the synthesis of bioactive molecules, highlighting its importance in drug development. Its versatile reactivity and potential for creating novel pharmaceutical agents underscore its pivotal role in contemporary medicinal chemistry research and its potential impact on the advancement of therapeutic compounds.
Catalog Number | L003739 |
CAS Number | 1814920-62-1 |
Molecular Formula | C7H8F2N2O |
Purity | ≥95% |
IUPAC Name | 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]ethanone |
InChI | InChI=1S/C7H8F2N2O/c1-4(12)5-3-11(2)10-6(5)7(8)9/h3,7H,1-2H3 |
InChIKey | BEZVCXLDJHKSQE-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CN(N=C1C(F)F)C |