For research use only. Not for therapeutic Use.
1-(3-Ethoxy-4-methoxyphenyl)ethanone(Cat No.:L040121)is an aromatic ketone commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. The compound features an ethanone group attached to a phenyl ring, which is further substituted with ethoxy and methoxy groups at the 3- and 4-positions, respectively. This structure provides reactivity that is valuable in creating complex organic molecules, including potential drug candidates. It is particularly useful in medicinal chemistry for the development of bioactive compounds, contributing to various chemical synthesis and research applications.
CAS Number | 31526-71-3 |
Molecular Formula | C11H14O3 |
Purity | ≥95% |
IUPAC Name | 1-(3-ethoxy-4-methoxyphenyl)ethanone |
InChI | InChI=1S/C11H14O3/c1-4-14-11-7-9(8(2)12)5-6-10(11)13-3/h5-7H,4H2,1-3H3 |
InChIKey | VYPAEKCKAWMJED-UHFFFAOYSA-N |
SMILES | CCOC1=C(C=CC(=C1)C(=O)C)OC |