For research use only. Not for therapeutic Use.
1-(3-Fluoro-2-methoxyphenyl)ethanone(Cat No.:L039228)is a useful intermediate in organic synthesis and pharmaceutical research. Featuring a fluoro and methoxy group on a phenyl ring with an ethanone moiety, it offers versatile reactivity for the development of bioactive compounds. This compound is commonly employed in the synthesis of potential therapeutic agents, including those used in anti-inflammatory, analgesic, or antimicrobial applications. Its structure allows for further modifications, making it valuable for creating novel molecules in medicinal chemistry, drug discovery, and other fine chemical processes.
CAS Number | 295779-86-1 |
Molecular Formula | C9H9FO2 |
Purity | ≥95% |
IUPAC Name | 1-(3-fluoro-2-methoxyphenyl)ethanone |
InChI | InChI=1S/C9H9FO2/c1-6(11)7-4-3-5-8(10)9(7)12-2/h3-5H,1-2H3 |
InChIKey | XWKGHXBPAPLVPW-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C(=CC=C1)F)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |