For research use only. Not for therapeutic Use.
1-(3-Fluoro-4-methoxyphenyl)ethan-1-amine hydrochloride(Cat No.:L007397), is a chemical compound used in various research and pharmaceutical applications. Its molecular formula is C9H12FNO•HCl. The compound consists of an ethylamine group attached to a phenyl ring, which is substituted with a fluorine atom at the 3rd position and a methoxy group at the 4th position. The hydrochloride salt form enhances the compound’s stability and solubility, making it suitable for laboratory studies and drug formulation.
CAS Number | 1375472-38-0 |
Molecular Formula | C9H13ClFNO |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)ethanamine;hydrochloride |
InChI | InChI=1S/C9H12FNO.ClH/c1-6(11)7-3-4-9(12-2)8(10)5-7;/h3-6H,11H2,1-2H3;1H |
InChIKey | IWQJXEXCMWBMQV-UHFFFAOYSA-N |
SMILES | CC(C1=CC(=C(C=C1)OC)F)N.Cl |