For research use only. Not for therapeutic Use.
1-(3-Fluorophenyl)butan-1-amine hydrochloride(Cat No.:L007902). This compound consists of a butylamine backbone with a fluorophenyl group at the 3-position, forming a hydrochloride salt for increased solubility and stability. Compounds like these are vital in medicinal chemistry research, serving as intermediates in the synthesis of potential drug candidates and other bioactive molecules. The unique arrangement of atoms in this compound offers opportunities for chemical modifications, allowing researchers to create diverse molecules for applications in drug discovery, neuroscience research, and related scientific endeavors, contributing to advancements in pharmaceutical science and medical research.
CAS Number | 1864074-37-2 |
Molecular Formula | C10H15ClFN |
Purity | ≥95% |
IUPAC Name | 1-(3-fluorophenyl)butan-1-amine;hydrochloride |
InChI | InChI=1S/C10H14FN.ClH/c1-2-4-10(12)8-5-3-6-9(11)7-8;/h3,5-7,10H,2,4,12H2,1H3;1H |
InChIKey | PJACYMKJBXMKIA-UHFFFAOYSA-N |
SMILES | CCCC(C1=CC(=CC=C1)F)N.Cl |