For research use only. Not for therapeutic Use.
1-(3-Fluorophenyl)cyclopropan-1-amine(CAT: L028626) is a high-purity fluorinated cyclopropyl amine derivative widely utilized in pharmaceutical and chemical research. Its structure, featuring a cyclopropane ring linked to a 3-fluorophenyl group and a primary amine functionality, makes it an ideal building block for synthesizing bioactive molecules, including potential drug candidates. The fluorine substitution enhances metabolic stability and biological activity, crucial for medicinal chemistry applications. 1-(3-Fluorophenyl)cyclopropan-1-amine is highly reactive and versatile, enabling functionalization in targeted chemical transformations. This compound supports innovative advancements in drug discovery, organic synthesis, and material science, providing researchers with a reliable tool for precision-driven applications.
CAS Number | 764647-70-3 |
Molecular Formula | C9H10FN |
Purity | ≥95% |
IUPAC Name | 1-(3-fluorophenyl)cyclopropan-1-amine |
InChI | InChI=1S/C9H10FN/c10-8-3-1-2-7(6-8)9(11)4-5-9/h1-3,6H,4-5,11H2 |
InChIKey | QVTZALHUUXQDTQ-UHFFFAOYSA-N |
SMILES | C1CC1(C2=CC(=CC=C2)F)N |