For research use only. Not for therapeutic Use.
1-(3-Fluorophenyl)propan-1-amine hydrochloride(CAT: L000366) is a notable compound with significant relevance in the pharmaceutical and organic chemistry domains. This chemical acts as a valuable intermediate in the synthesis of various pharmaceuticals, particularly those targeting the central nervous system. It can be utilized to prepare novel drugs with potential applications in treating neurological disorders or psychiatric conditions.
CAS Number | 844470-86-6 |
Molecular Formula | C9H13ClFN |
Purity | ≥95% |
IUPAC Name | 1-(3-fluorophenyl)propan-1-amine;hydrochloride |
InChI | InChI=1S/C9H12FN.ClH/c1-2-9(11)7-4-3-5-8(10)6-7;/h3-6,9H,2,11H2,1H3;1H |
InChIKey | ODZRCWFYKMOLKD-UHFFFAOYSA-N |