For research use only. Not for therapeutic Use.
1-(3-Fluoroquinolin-7-yl)ethanone(CAT: L018061) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a quinoline core substituted with a fluorine atom at the 3-position and an ethanone group at the 1-position, this compound serves as a versatile intermediate in the synthesis of bioactive molecules and drug candidates. Its unique structure and reactivity make it ideal for applications in medicinal chemistry, particularly in the development of enzyme inhibitors and therapeutic agents. 1-(3-Fluoroquinolin-7-yl)ethanone ensures reliable performance, supporting innovative research in drug discovery and fine chemical production.
CAS Number | 1958100-78-1 |
Molecular Formula | C11H8FNO |
Purity | ≥95% |
IUPAC Name | 1-(3-fluoroquinolin-7-yl)ethanone |
InChI | InChI=1S/C11H8FNO/c1-7(14)8-2-3-9-4-10(12)6-13-11(9)5-8/h2-6H,1H3 |
InChIKey | SWWVJBNDHGDTJF-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC2=NC=C(C=C2C=C1)F |